C31H40O6SSi — CID 146164181
[(2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3-prop-2-enoxypentyl] 4-methylbenzenesulfonate (PubChem CID 146164181) has the molecular formula C31H40O6SSi and a molecular weight of 568.81 g/mol. Its IUPAC name is [(2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3-prop-2-enoxypentyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3-prop-2-enoxypentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 146164181 |
| Molecular Formula | C31H40O6SSi |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | [(2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3-prop-2-enoxypentyl] 4-methylbenzenesulfonate |
| SMILES | C=CCO[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H40O6SSi/c1-6-22-35-30(29(32)24-36-38(33,34)26-19-17-25(2)18-20-26)21-23-37-39(31(3,4)5,27-13-9-7-10-14-27)28-15-11-8-12-16-28/h6-20,29-30,32H,1,21-24H2,2-5H3/t29-,30+/m0/s1 |
| InChIKey | VGEVLHIPQWQHCL-XZWHSSHBSA-N |
| XLogP | 4.60 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|