C28H49N2O11PSSi2 — CID 154432002
[6-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-4-methyl-2-(2-trimethylsilylethoxycarbonylsulfamoylamino)hex-4-enyl]phosphonic acid (PubChem CID 154432002) has the molecular formula C28H49N2O11PSSi2 and a molecular weight of 708.92 g/mol. Its IUPAC name is [6-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-4-methyl-2-(2-trimethylsilylethoxycarbonylsulfamoylamino)hex-4-enyl]phosphonic acid.
| Compound Name | [6-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-4-methyl-2-(2-trimethylsilylethoxycarbonylsulfamoylamino)hex-4-enyl]phosphonic acid |
|---|---|
| PubChem CID | 154432002 |
| Molecular Formula | C28H49N2O11PSSi2 |
| Molecular Weight | 708.92 g/mol |
| Exact Mass | 708.23 |
| IUPAC Name | [6-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-4-methyl-2-(2-trimethylsilylethoxycarbonylsulfamoylamino)hex-4-enyl]phosphonic acid |
| SMILES | COc1c(C)c2c(c(OCC[Si](C)(C)C)c1CC=C(C)CC(CP(=O)(O)O)NS(=O)(=O)NC(=O)OCC[Si](C)(C)C)C(=O)OC2 |
| InChI | InChI=1S/C28H49N2O11PSSi2/c1-19(16-21(18-42(33,34)35)29-43(36,37)30-28(32)40-13-15-45(7,8)9)10-11-22-25(38-3)20(2)23-17-41-27(31)24(23)26(22)39-12-14-44(4,5)6/h10,21,29H,11-18H2,1-9H3,(H,30,32)(H2,33,34,35) |
| InChIKey | YYIZDFLYEUSIOJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 186.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|