C29H37ClN4O5 — CID 154434986
methyl N-[(4S)-4-[3-chloro-2-(3-methylphenyl)phenyl]-4-[(3R)-1-(2,5-diamino-4-oxopent-2-enoyl)piperidin-3-yl]-4-hydroxybutyl]carbamate (PubChem CID 154434986) has the molecular formula C29H37ClN4O5 and a molecular weight of 557.09 g/mol. Its IUPAC name is methyl N-[(4S)-4-[3-chloro-2-(3-methylphenyl)phenyl]-4-[(3R)-1-(2,5-diamino-4-oxopent-2-enoyl)piperidin-3-yl]-4-hydroxybutyl]carbamate.
| Compound Name | methyl N-[(4S)-4-[3-chloro-2-(3-methylphenyl)phenyl]-4-[(3R)-1-(2,5-diamino-4-oxopent-2-enoyl)piperidin-3-yl]-4-hydroxybutyl]carbamate |
|---|---|
| PubChem CID | 154434986 |
| Molecular Formula | C29H37ClN4O5 |
| Molecular Weight | 557.09 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | methyl N-[(4S)-4-[3-chloro-2-(3-methylphenyl)phenyl]-4-[(3R)-1-(2,5-diamino-4-oxopent-2-enoyl)piperidin-3-yl]-4-hydroxybutyl]carbamate |
| SMILES | COC(=O)NCCC[C@@](O)(c1cccc(Cl)c1-c1cccc(C)c1)[C@@H]1CCCN(C(=O)C(N)=CC(=O)CN)C1 |
| InChI | InChI=1S/C29H37ClN4O5/c1-19-7-3-8-20(15-19)26-23(10-4-11-24(26)30)29(38,12-6-13-33-28(37)39-2)21-9-5-14-34(18-21)27(36)25(32)16-22(35)17-31/h3-4,7-8,10-11,15-16,21,38H,5-6,9,12-14,17-18,31-32H2,1-2H3,(H,33,37)/t21-,29+/m1/s1 |
| InChIKey | NHSOSMXRSCIZLK-PBBNMVCDSA-N |
| XLogP | 3.25 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.09 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|