C24H41IN+ — CID 154502673
dihexyl-[(1-iodo-2,6-dimethylcyclohexa-2,4-dien-1-yl)methyl]-prop-2-ynylazanium (PubChem CID 154502673) has the molecular formula C24H41IN+ and a molecular weight of 470.50 g/mol. Its IUPAC name is dihexyl-[(1-iodo-2,6-dimethylcyclohexa-2,4-dien-1-yl)methyl]-prop-2-ynylazanium.
| Compound Name | dihexyl-[(1-iodo-2,6-dimethylcyclohexa-2,4-dien-1-yl)methyl]-prop-2-ynylazanium |
|---|---|
| PubChem CID | 154502673 |
| Molecular Formula | C24H41IN+ |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | dihexyl-[(1-iodo-2,6-dimethylcyclohexa-2,4-dien-1-yl)methyl]-prop-2-ynylazanium |
| SMILES | C#CC[N+](CCCCCC)(CCCCCC)CC1(I)C(C)=CC=CC1C |
| InChI | InChI=1S/C24H41IN/c1-6-9-11-13-19-26(18-8-3,20-14-12-10-7-2)21-24(25)22(4)16-15-17-23(24)5/h3,15-17,22H,6-7,9-14,18-21H2,1-2,4-5H3/q+1 |
| InChIKey | BHQGTTPYSVEGTF-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|