C18H27Cl3IN — CID 172732555
dibutyl-[(4,6-dichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl]-prop-2-ynylazanium chloride (PubChem CID 172732555) has the molecular formula C18H27Cl3IN and a molecular weight of 490.68 g/mol. Its IUPAC name is dibutyl-[(4,6-dichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl]-prop-2-ynylazanium chloride.
| Compound Name | dibutyl-[(4,6-dichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl]-prop-2-ynylazanium chloride |
|---|---|
| PubChem CID | 172732555 |
| Molecular Formula | C18H27Cl3IN |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | dibutyl-[(4,6-dichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl]-prop-2-ynylazanium chloride |
| SMILES | C#CC[N+](CCCC)(CCCC)CC1(I)C=CC(Cl)=CC1Cl.[Cl-] |
| InChI | InChI=1S/C18H27Cl2IN.ClH/c1-4-7-12-22(11-6-3,13-8-5-2)15-18(21)10-9-16(19)14-17(18)20;/h3,9-10,14,17H,4-5,7-8,11-13,15H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HZLLSSIPAGFJDG-UHFFFAOYSA-M |
| XLogP | 2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|