C26H45ClIN — CID 172789812
(1-iodocyclohexa-2,4-dien-1-yl)methyl-dioctyl-prop-2-ynylazanium chloride (PubChem CID 172789812) has the molecular formula C26H45ClIN and a molecular weight of 534.01 g/mol. Its IUPAC name is (1-iodocyclohexa-2,4-dien-1-yl)methyl-dioctyl-prop-2-ynylazanium chloride.
| Compound Name | (1-iodocyclohexa-2,4-dien-1-yl)methyl-dioctyl-prop-2-ynylazanium chloride |
|---|---|
| PubChem CID | 172789812 |
| Molecular Formula | C26H45ClIN |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | (1-iodocyclohexa-2,4-dien-1-yl)methyl-dioctyl-prop-2-ynylazanium chloride |
| SMILES | C#CC[N+](CCCCCCCC)(CCCCCCCC)CC1(I)C=CC=CC1.[Cl-] |
| InChI | InChI=1S/C26H45IN.ClH/c1-4-7-9-11-13-18-23-28(22-6-3,24-19-14-12-10-8-5-2)25-26(27)20-16-15-17-21-26;/h3,15-17,20H,4-5,7-14,18-19,21-25H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PKDLWHUCSLOIHJ-UHFFFAOYSA-M |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|