C22H34Cl4IN — CID 172758527
dihexyl-prop-2-ynyl-[(2,4,6-trichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl]azanium chloride (PubChem CID 172758527) has the molecular formula C22H34Cl4IN and a molecular weight of 581.24 g/mol. Its IUPAC name is dihexyl-prop-2-ynyl-[(2,4,6-trichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl]azanium chloride.
| Compound Name | dihexyl-prop-2-ynyl-[(2,4,6-trichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl]azanium chloride |
|---|---|
| PubChem CID | 172758527 |
| Molecular Formula | C22H34Cl4IN |
| Molecular Weight | 581.24 g/mol |
| Exact Mass | 579.05 |
| IUPAC Name | dihexyl-prop-2-ynyl-[(2,4,6-trichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl]azanium chloride |
| SMILES | C#CC[N+](CCCCCC)(CCCCCC)CC1(I)C(Cl)=CC(Cl)=CC1Cl.[Cl-] |
| InChI | InChI=1S/C22H34Cl3IN.ClH/c1-4-7-9-11-14-27(13-6-3,15-12-10-8-5-2)18-22(26)20(24)16-19(23)17-21(22)25;/h3,16-17,20H,4-5,7-15,18H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | LJARGCYTLYSTJM-UHFFFAOYSA-M |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.24 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|