C24H38Cl3IN+ — CID 172803774
diheptyl-prop-2-ynyl-[(2,4,6-trichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl]azanium (PubChem CID 172803774) has the molecular formula C24H38Cl3IN+ and a molecular weight of 573.84 g/mol. Its IUPAC name is diheptyl-prop-2-ynyl-[(2,4,6-trichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl]azanium.
| Compound Name | diheptyl-prop-2-ynyl-[(2,4,6-trichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 172803774 |
| Molecular Formula | C24H38Cl3IN+ |
| Molecular Weight | 573.84 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | diheptyl-prop-2-ynyl-[(2,4,6-trichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl]azanium |
| SMILES | C#CC[N+](CCCCCCC)(CCCCCCC)CC1(I)C(Cl)=CC(Cl)=CC1Cl |
| InChI | InChI=1S/C24H38Cl3IN/c1-4-7-9-11-13-16-29(15-6-3,17-14-12-10-8-5-2)20-24(28)22(26)18-21(25)19-23(24)27/h3,18-19,22H,4-5,7-17,20H2,1-2H3/q+1 |
| InChIKey | KQKXPJOJMQKUNV-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.84 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|