C12H20ClNSi — CID 154509431
4-[chloro(phenyl)silyl]-N,N-dimethylbutan-1-amine (PubChem CID 154509431) has the molecular formula C12H20ClNSi and a molecular weight of 241.84 g/mol. Its IUPAC name is 4-[chloro(phenyl)silyl]-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[chloro(phenyl)silyl]-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 154509431 |
| Molecular Formula | C12H20ClNSi |
| Molecular Weight | 241.84 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4-[chloro(phenyl)silyl]-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCC[SiH](Cl)c1ccccc1 |
| InChI | InChI=1S/C12H20ClNSi/c1-14(2)10-6-7-11-15(13)12-8-4-3-5-9-12/h3-5,8-9,15H,6-7,10-11H2,1-2H3 |
| InChIKey | NFGYKZUDBHLIAW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.84 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|