C15H14F4O4S — CID 154540791
2,3,5,6-tetrafluoro-4-(1-tricyclo[3.3.1.03,7]nonanyloxy)benzenesulfonic acid (PubChem CID 154540791) has the molecular formula C15H14F4O4S and a molecular weight of 366.33 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(1-tricyclo[3.3.1.03,7]nonanyloxy)benzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-(1-tricyclo[3.3.1.03,7]nonanyloxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 154540791 |
| Molecular Formula | C15H14F4O4S |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(1-tricyclo[3.3.1.03,7]nonanyloxy)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1c(F)c(F)c(OC23CC4CC(C2)C(C4)C3)c(F)c1F |
| InChI | InChI=1S/C15H14F4O4S/c16-9-11(18)14(24(20,21)22)12(19)10(17)13(9)23-15-3-6-1-7(4-15)8(2-6)5-15/h6-8H,1-5H2,(H,20,21,22) |
| InChIKey | WUGVVRFKCCTURN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|