C18H20F4O5S — CID 89153454
4-[2-(1-adamantyloxy)ethoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 89153454) has the molecular formula C18H20F4O5S and a molecular weight of 424.41 g/mol. Its IUPAC name is 4-[2-(1-adamantyloxy)ethoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-[2-(1-adamantyloxy)ethoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 89153454 |
| Molecular Formula | C18H20F4O5S |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 4-[2-(1-adamantyloxy)ethoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1c(F)c(F)c(OCCOC23CC4CC(CC(C4)C2)C3)c(F)c1F |
| InChI | InChI=1S/C18H20F4O5S/c19-12-14(21)17(28(23,24)25)15(22)13(20)16(12)26-1-2-27-18-6-9-3-10(7-18)5-11(4-9)8-18/h9-11H,1-8H2,(H,23,24,25) |
| InChIKey | CIMMXBJFLRKTDK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|