C19H21I3O6S — CID 177131757
3-[2-(adamantane-1-carbonyloxy)ethoxy]-2,4,6-triiodobenzenesulfonic acid (PubChem CID 177131757) has the molecular formula C19H21I3O6S and a molecular weight of 758.15 g/mol. Its IUPAC name is 3-[2-(adamantane-1-carbonyloxy)ethoxy]-2,4,6-triiodobenzenesulfonic acid.
| Compound Name | 3-[2-(adamantane-1-carbonyloxy)ethoxy]-2,4,6-triiodobenzenesulfonic acid |
|---|---|
| PubChem CID | 177131757 |
| Molecular Formula | C19H21I3O6S |
| Molecular Weight | 758.15 g/mol |
| Exact Mass | 757.82 |
| IUPAC Name | 3-[2-(adamantane-1-carbonyloxy)ethoxy]-2,4,6-triiodobenzenesulfonic acid |
| SMILES | O=C(OCCOc1c(I)cc(I)c(S(=O)(=O)O)c1I)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H21I3O6S/c20-13-6-14(21)17(29(24,25)26)15(22)16(13)27-1-2-28-18(23)19-7-10-3-11(8-19)5-12(4-10)9-19/h6,10-12H,1-5,7-9H2,(H,24,25,26) |
| InChIKey | PPJGQNCPCVVBSN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.15 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|