C19H18F2N4O — CID 154588363
2-[4-(3-deuteriopiperidin-3-yl)-2-fluorophenyl]-3-fluoroindazole-7-carboxamide (PubChem CID 154588363) has the molecular formula C19H18F2N4O and a molecular weight of 357.38 g/mol. Its IUPAC name is 2-[4-(3-deuteriopiperidin-3-yl)-2-fluorophenyl]-3-fluoroindazole-7-carboxamide.
| Compound Name | 2-[4-(3-deuteriopiperidin-3-yl)-2-fluorophenyl]-3-fluoroindazole-7-carboxamide |
|---|---|
| PubChem CID | 154588363 |
| Molecular Formula | C19H18F2N4O |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-[4-(3-deuteriopiperidin-3-yl)-2-fluorophenyl]-3-fluoroindazole-7-carboxamide |
| SMILES | [2H]C1(c2ccc(-n3nc4c(C(N)=O)cccc4c3F)c(F)c2)CCCNC1 |
| InChI | InChI=1S/C19H18F2N4O/c20-15-9-11(12-3-2-8-23-10-12)6-7-16(15)25-18(21)13-4-1-5-14(19(22)26)17(13)24-25/h1,4-7,9,12,23H,2-3,8,10H2,(H2,22,26)/i12D |
| InChIKey | UGMODZWPKKTUDC-UQBWLURTSA-N |
| XLogP | 2.87 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |