About 2-deuterio-2,3-dimethylbutane
2-deuterio-2,3-dimethylbutane (PubChem CID 154589489) has the molecular formula C6H14
and a molecular weight of 87.18 g/mol. Its IUPAC name is 2-deuterio-2,3-dimethylbutane.
Molecular Properties
| Compound Name | 2-deuterio-2,3-dimethylbutane |
| PubChem CID | 154589489 |
| Molecular Formula | C6H14 |
| Molecular Weight | 87.18 g/mol |
| Exact Mass | 87.12 |
| IUPAC Name | 2-deuterio-2,3-dimethylbutane |
| SMILES | [2H]C(C)(C)C(C)C |
| InChI | InChI=1S/C6H14/c1-5(2)6(3)4/h5-6H,1-4H3/i5D |
| InChIKey | ZFFMLCVRJBZUDZ-UICOGKGYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-deuterio-2,3-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuterio-2,3-dimethylbutane?
The IUPAC name of 2-deuterio-2,3-dimethylbutane (CID 154589489) is 2-deuterio-2,3-dimethylbutane.
What is the SMILES notation for 2-deuterio-2,3-dimethylbutane?
The canonical SMILES for 2-deuterio-2,3-dimethylbutane is [2H]C(C)(C)C(C)C.
What is the InChIKey of 2-deuterio-2,3-dimethylbutane?
The InChIKey is ZFFMLCVRJBZUDZ-UICOGKGYSA-N. The full InChI is InChI=1S/C6H14/c1-5(2)6(3)4/h5-6H,1-4H3/i5D.
What are the key properties of 2-deuterio-2,3-dimethylbutane?
2-deuterio-2,3-dimethylbutane has a molecular weight of 87.18 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuterio-2,3-dimethylbutane is sourced from PubChem (CID 154589489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).