C13H14Cl2O2 — CID 154641414
2-(2,4-dichlorophenyl)-2-methyl-4-propyl-1,3-dioxole (PubChem CID 154641414) has the molecular formula C13H14Cl2O2 and a molecular weight of 273.16 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-2-methyl-4-propyl-1,3-dioxole.
| Compound Name | 2-(2,4-dichlorophenyl)-2-methyl-4-propyl-1,3-dioxole |
|---|---|
| PubChem CID | 154641414 |
| Molecular Formula | C13H14Cl2O2 |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-2-methyl-4-propyl-1,3-dioxole |
| SMILES | CCCC1=COC(C)(c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C13H14Cl2O2/c1-3-4-10-8-16-13(2,17-10)11-6-5-9(14)7-12(11)15/h5-8H,3-4H2,1-2H3 |
| InChIKey | QIFDGDVZQWQJFR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |