C19H24F2N2O2 — CID 154673368
(3R,4S)-4-[(3E)-5-fluoro-4,5-dimethylhexa-1,3-dien-2-yl]-N-(2-fluorophenyl)-2-oxopyrrolidine-3-carboxamide;molecular hydrogen (PubChem CID 154673368) has the molecular formula C19H24F2N2O2 and a molecular weight of 350.41 g/mol. Its IUPAC name is (3R,4S)-4-[(3E)-5-fluoro-4,5-dimethylhexa-1,3-dien-2-yl]-N-(2-fluorophenyl)-2-oxopyrrolidine-3-carboxamide;molecular hydrogen.
| Compound Name | (3R,4S)-4-[(3E)-5-fluoro-4,5-dimethylhexa-1,3-dien-2-yl]-N-(2-fluorophenyl)-2-oxopyrrolidine-3-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 154673368 |
| Molecular Formula | C19H24F2N2O2 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (3R,4S)-4-[(3E)-5-fluoro-4,5-dimethylhexa-1,3-dien-2-yl]-N-(2-fluorophenyl)-2-oxopyrrolidine-3-carboxamide;molecular hydrogen |
| SMILES | C=C(/C=C(\C)C(C)(C)F)[C@H]1CNC(=O)[C@@H]1C(=O)Nc1ccccc1F.[H][H] |
| InChI | InChI=1S/C19H22F2N2O2.H2/c1-11(9-12(2)19(3,4)21)13-10-22-17(24)16(13)18(25)23-15-8-6-5-7-14(15)20;/h5-9,13,16H,1,10H2,2-4H3,(H,22,24)(H,23,25);1H/b12-9+;/t13-,16-;/m1./s1 |
| InChIKey | BLRNOSBCBOLJTB-XEWKCTHQSA-N |
| XLogP | 3.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|