C8H14FNO3S — CID 154676723
4-oxo-4-[2-(2-sulfanylethoxy)ethylamino]butanoyl fluoride (PubChem CID 154676723) has the molecular formula C8H14FNO3S and a molecular weight of 223.27 g/mol. Its IUPAC name is 4-oxo-4-[2-(2-sulfanylethoxy)ethylamino]butanoyl fluoride.
| Compound Name | 4-oxo-4-[2-(2-sulfanylethoxy)ethylamino]butanoyl fluoride |
|---|---|
| PubChem CID | 154676723 |
| Molecular Formula | C8H14FNO3S |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 4-oxo-4-[2-(2-sulfanylethoxy)ethylamino]butanoyl fluoride |
| SMILES | O=C(F)CCC(=O)NCCOCCS |
| InChI | InChI=1S/C8H14FNO3S/c9-7(11)1-2-8(12)10-3-4-13-5-6-14/h14H,1-6H2,(H,10,12) |
| InChIKey | PTMDXPUULSZXEK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|