C11H13N4O3S+ — CID 154679158
2-[4-(6-methylpyridazin-3-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid (PubChem CID 154679158) has the molecular formula C11H13N4O3S+ and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-[4-(6-methylpyridazin-3-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid.
| Compound Name | 2-[4-(6-methylpyridazin-3-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 154679158 |
| Molecular Formula | C11H13N4O3S+ |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-[4-(6-methylpyridazin-3-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid |
| SMILES | Cc1ccc(-c2cc[n+](CCS(=O)(=O)O)nc2)nn1 |
| InChI | InChI=1S/C11H12N4O3S/c1-9-2-3-11(14-13-9)10-4-5-15(12-8-10)6-7-19(16,17)18/h2-5,8H,6-7H2,1H3/p+1 |
| InChIKey | CBGWWDXQGWYPCG-UHFFFAOYSA-O |
| XLogP | 0.02 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|