C24H26FNO4S — CID 154718920
tert-butyl 2-[(4-fluorophenyl)-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]methyl]prop-2-enoate (PubChem CID 154718920) has the molecular formula C24H26FNO4S and a molecular weight of 443.54 g/mol. Its IUPAC name is tert-butyl 2-[(4-fluorophenyl)-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]methyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[(4-fluorophenyl)-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 154718920 |
| Molecular Formula | C24H26FNO4S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | tert-butyl 2-[(4-fluorophenyl)-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]methyl]prop-2-enoate |
| SMILES | C#CCN(C(C(=C)C(=O)OC(C)(C)C)c1ccc(F)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H26FNO4S/c1-7-16-26(31(28,29)21-14-8-17(2)9-15-21)22(19-10-12-20(25)13-11-19)18(3)23(27)30-24(4,5)6/h1,8-15,22H,3,16H2,2,4-6H3 |
| InChIKey | WPULTCPMDLRXBE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|