C20H34O3Si — CID 154720810
(1R,5S,6E,10R)-3-[tert-butyl(dimethyl)silyl]oxy-8-methylidene-5-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-2-one (PubChem CID 154720810) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (1R,5S,6E,10R)-3-[tert-butyl(dimethyl)silyl]oxy-8-methylidene-5-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-2-one.
| Compound Name | (1R,5S,6E,10R)-3-[tert-butyl(dimethyl)silyl]oxy-8-methylidene-5-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-2-one |
|---|---|
| PubChem CID | 154720810 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (1R,5S,6E,10R)-3-[tert-butyl(dimethyl)silyl]oxy-8-methylidene-5-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-2-one |
| SMILES | C=C1/C=C/[C@H](C(C)C)CC(O[Si](C)(C)C(C)(C)C)C(=O)[C@@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C20H34O3Si/c1-13(2)15-10-9-14(3)11-17-19(22-17)18(21)16(12-15)23-24(7,8)20(4,5)6/h9-10,13,15-17,19H,3,11-12H2,1-2,4-8H3/b10-9+/t15-,16?,17+,19+/m0/s1 |
| InChIKey | SGISTVPJDKYUDP-XLSGHONESA-N |
| XLogP | 4.89 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|