C14H13N2O3+ — CID 15475388
4,8-dimethyl-2-oxo-7-prop-2-enoxychromene-6-diazonium (PubChem CID 15475388) has the molecular formula C14H13N2O3+ and a molecular weight of 257.27 g/mol. Its IUPAC name is 4,8-dimethyl-2-oxo-7-prop-2-enoxychromene-6-diazonium.
| Compound Name | 4,8-dimethyl-2-oxo-7-prop-2-enoxychromene-6-diazonium |
|---|---|
| PubChem CID | 15475388 |
| Molecular Formula | C14H13N2O3+ |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4,8-dimethyl-2-oxo-7-prop-2-enoxychromene-6-diazonium |
| SMILES | C=CCOc1c([N+]#N)cc2c(C)cc(=O)oc2c1C |
| InChI | InChI=1S/C14H13N2O3/c1-4-5-18-14-9(3)13-10(7-11(14)16-15)8(2)6-12(17)19-13/h4,6-7H,1,5H2,2-3H3/q+1 |
| InChIKey | GNRBCUBVJHKSSV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|