C19H24N2O4 — CID 154785148
1-[(5-hydroxy-4-oxopyran-2-yl)methyl]-3-(2-propan-2-yl-6-propylphenyl)urea (PubChem CID 154785148) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-[(5-hydroxy-4-oxopyran-2-yl)methyl]-3-(2-propan-2-yl-6-propylphenyl)urea.
| Compound Name | 1-[(5-hydroxy-4-oxopyran-2-yl)methyl]-3-(2-propan-2-yl-6-propylphenyl)urea |
|---|---|
| PubChem CID | 154785148 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[(5-hydroxy-4-oxopyran-2-yl)methyl]-3-(2-propan-2-yl-6-propylphenyl)urea |
| SMILES | CCCc1cccc(C(C)C)c1NC(=O)NCc1cc(=O)c(O)co1 |
| InChI | InChI=1S/C19H24N2O4/c1-4-6-13-7-5-8-15(12(2)3)18(13)21-19(24)20-10-14-9-16(22)17(23)11-25-14/h5,7-9,11-12,23H,4,6,10H2,1-3H3,(H2,20,21,24) |
| InChIKey | HDTSMFRFCGQPBZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |