C31H28O5S — CID 15480614
4-(benzenesulfonyl)-3-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2,3-dihydrofuran (PubChem CID 15480614) has the molecular formula C31H28O5S and a molecular weight of 512.63 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-3-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2,3-dihydrofuran.
| Compound Name | 4-(benzenesulfonyl)-3-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2,3-dihydrofuran |
|---|---|
| PubChem CID | 15480614 |
| Molecular Formula | C31H28O5S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 4-(benzenesulfonyl)-3-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-2,3-dihydrofuran |
| SMILES | COc1ccc(C(OCC2COC=C2S(=O)(=O)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H28O5S/c1-34-28-19-17-27(18-20-28)31(25-11-5-2-6-12-25,26-13-7-3-8-14-26)36-22-24-21-35-23-30(24)37(32,33)29-15-9-4-10-16-29/h2-20,23-24H,21-22H2,1H3 |
| InChIKey | BSMXFGOUOLJFQT-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|