C23H36N2OS2 — CID 154808903
1-[(1S,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-5-(dithiolan-3-yl)pentan-1-one (PubChem CID 154808903) has the molecular formula C23H36N2OS2 and a molecular weight of 420.69 g/mol. Its IUPAC name is 1-[(1S,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-5-(dithiolan-3-yl)pentan-1-one.
| Compound Name | 1-[(1S,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-5-(dithiolan-3-yl)pentan-1-one |
|---|---|
| PubChem CID | 154808903 |
| Molecular Formula | C23H36N2OS2 |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1-[(1S,2S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-5-(dithiolan-3-yl)pentan-1-one |
| SMILES | O=C(CCCCC1CCSS1)N1CCCC2=C[C@@H]3C[C@@H](CN4CCCC[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C23H36N2OS2/c26-22(9-2-1-7-20-10-13-27-28-20)25-12-5-6-17-14-18-15-19(23(17)25)16-24-11-4-3-8-21(18)24/h14,18-21,23H,1-13,15-16H2/t18-,19+,20?,21-,23-/m1/s1 |
| InChIKey | IBUFIYXHQCZETR-OODFZBMISA-N |
| XLogP | 5.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|