C24H39N3O — CID 154969119
1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]propan-1-one (PubChem CID 154969119) has the molecular formula C24H39N3O and a molecular weight of 385.60 g/mol. Its IUPAC name is 1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]propan-1-one.
| Compound Name | 1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]propan-1-one |
|---|---|
| PubChem CID | 154969119 |
| Molecular Formula | C24H39N3O |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.31 |
| IUPAC Name | 1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]propan-1-one |
| SMILES | [H]/N=C/C=N\NCCC(=O)C1CCC2C3CCC4CC(C)CCC4C3CCC12C |
| InChI | InChI=1S/C24H39N3O/c1-16-3-5-18-17(15-16)4-6-20-19(18)9-11-24(2)21(20)7-8-22(24)23(28)10-13-26-27-14-12-25/h12,14,16-22,25-26H,3-11,13,15H2,1-2H3/b25-12+,27-14- |
| InChIKey | RMTLURMAOBTKNE-SUYYGPINSA-N |
| XLogP | 5.08 |
| TPSA | 65.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|