C34H33NO2 — CID 154970529
(2E)-2-[(7-tert-butyl-9,9,10-trimethylacridin-2-yl)methylidene]-8a,9-dihydrocyclopenta[b]naphthalene-1,3-dione (PubChem CID 154970529) has the molecular formula C34H33NO2 and a molecular weight of 487.64 g/mol. Its IUPAC name is (2E)-2-[(7-tert-butyl-9,9,10-trimethylacridin-2-yl)methylidene]-8a,9-dihydrocyclopenta[b]naphthalene-1,3-dione.
| Compound Name | (2E)-2-[(7-tert-butyl-9,9,10-trimethylacridin-2-yl)methylidene]-8a,9-dihydrocyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 154970529 |
| Molecular Formula | C34H33NO2 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (2E)-2-[(7-tert-butyl-9,9,10-trimethylacridin-2-yl)methylidene]-8a,9-dihydrocyclopenta[b]naphthalene-1,3-dione |
| SMILES | CN1c2ccc(/C=C3/C(=O)C4=C(CC5C=CC=CC5=C4)C3=O)cc2C(C)(C)c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C34H33NO2/c1-33(2,3)23-12-14-30-28(19-23)34(4,5)27-16-20(11-13-29(27)35(30)6)15-26-31(36)24-17-21-9-7-8-10-22(21)18-25(24)32(26)37/h7-17,19,22H,18H2,1-6H3/b26-15- |
| InChIKey | CBYGGUIMSZDFKG-YSMPRRRNSA-N |
| XLogP | 7.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|