C15H18FNO5S — CID 155021888
methyl 5-[[(4E)-5-fluoro-2-methylhexa-2,4-dien-3-yl]sulfamoyl]-2-hydroxybenzoate (PubChem CID 155021888) has the molecular formula C15H18FNO5S and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl 5-[[(4E)-5-fluoro-2-methylhexa-2,4-dien-3-yl]sulfamoyl]-2-hydroxybenzoate.
| Compound Name | methyl 5-[[(4E)-5-fluoro-2-methylhexa-2,4-dien-3-yl]sulfamoyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 155021888 |
| Molecular Formula | C15H18FNO5S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | methyl 5-[[(4E)-5-fluoro-2-methylhexa-2,4-dien-3-yl]sulfamoyl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NC(/C=C(\C)F)=C(C)C)ccc1O |
| InChI | InChI=1S/C15H18FNO5S/c1-9(2)13(7-10(3)16)17-23(20,21)11-5-6-14(18)12(8-11)15(19)22-4/h5-8,17-18H,1-4H3/b10-7+ |
| InChIKey | DEPMXENSSZEXLX-JXMROGBWSA-N |
| XLogP | 2.62 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|