C37H41FO7 — CID 155030695
[4-(2-prop-2-enoyloxyethyl)phenyl] (E)-3-[3-fluoro-4-[4-[6-(2-hydroxy-3-methylbut-3-en-2-yl)oxyhexoxy]phenyl]phenyl]prop-2-enoate (PubChem CID 155030695) has the molecular formula C37H41FO7 and a molecular weight of 616.73 g/mol. Its IUPAC name is [4-(2-prop-2-enoyloxyethyl)phenyl] (E)-3-[3-fluoro-4-[4-[6-(2-hydroxy-3-methylbut-3-en-2-yl)oxyhexoxy]phenyl]phenyl]prop-2-enoate.
| Compound Name | [4-(2-prop-2-enoyloxyethyl)phenyl] (E)-3-[3-fluoro-4-[4-[6-(2-hydroxy-3-methylbut-3-en-2-yl)oxyhexoxy]phenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 155030695 |
| Molecular Formula | C37H41FO7 |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | [4-(2-prop-2-enoyloxyethyl)phenyl] (E)-3-[3-fluoro-4-[4-[6-(2-hydroxy-3-methylbut-3-en-2-yl)oxyhexoxy]phenyl]phenyl]prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(OC(=O)/C=C/c2ccc(-c3ccc(OCCCCCCOC(C)(O)C(=C)C)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C37H41FO7/c1-5-35(39)43-25-22-28-10-16-32(17-11-28)45-36(40)21-13-29-12-20-33(34(38)26-29)30-14-18-31(19-15-30)42-23-8-6-7-9-24-44-37(4,41)27(2)3/h5,10-21,26,41H,1-2,6-9,22-25H2,3-4H3/b21-13+ |
| InChIKey | QAASNIDZYFIYAG-FYJGNVAPSA-N |
| XLogP | 7.62 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|