C7H7F2N2O2+ — CID 155054434
1-(2,2-difluoroethyl)pyridazin-1-ium-4-carboxylic acid (PubChem CID 155054434) has the molecular formula C7H7F2N2O2+ and a molecular weight of 189.14 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)pyridazin-1-ium-4-carboxylic acid.
| Compound Name | 1-(2,2-difluoroethyl)pyridazin-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 155054434 |
| Molecular Formula | C7H7F2N2O2+ |
| Molecular Weight | 189.14 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 1-(2,2-difluoroethyl)pyridazin-1-ium-4-carboxylic acid |
| SMILES | O=C(O)c1cc[n+](CC(F)F)nc1 |
| InChI | InChI=1S/C7H6F2N2O2/c8-6(9)4-11-2-1-5(3-10-11)7(12)13/h1-3,6H,4H2/p+1 |
| InChIKey | IUZCYRHJEZQWIY-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 54.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.14 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|