C14H18F3N2O5+ — CID 154674130
methyl 1-(3-methoxy-3-oxopropyl)pyridazin-1-ium-4-carboxylate;3,3,3-trifluoro-2-methoxyprop-1-ene (PubChem CID 154674130) has the molecular formula C14H18F3N2O5+ and a molecular weight of 351.30 g/mol. Its IUPAC name is methyl 1-(3-methoxy-3-oxopropyl)pyridazin-1-ium-4-carboxylate;3,3,3-trifluoro-2-methoxyprop-1-ene.
| Compound Name | methyl 1-(3-methoxy-3-oxopropyl)pyridazin-1-ium-4-carboxylate;3,3,3-trifluoro-2-methoxyprop-1-ene |
|---|---|
| PubChem CID | 154674130 |
| Molecular Formula | C14H18F3N2O5+ |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | methyl 1-(3-methoxy-3-oxopropyl)pyridazin-1-ium-4-carboxylate;3,3,3-trifluoro-2-methoxyprop-1-ene |
| SMILES | C=C(OC)C(F)(F)F.COC(=O)CC[n+]1ccc(C(=O)OC)cn1 |
| InChI | InChI=1S/C10H13N2O4.C4H5F3O/c1-15-9(13)4-6-12-5-3-8(7-11-12)10(14)16-2;1-3(8-2)4(5,6)7/h3,5,7H,4,6H2,1-2H3;1H2,2H3/q+1; |
| InChIKey | QTNQQMUEPLKDRQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 78.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|