C14H22N4O4S — CID 155068282
(2S,5R)-N-(1-azabicyclo[2.2.2]octan-3-yloxy)-7-oxo-6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 155068282) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is (2S,5R)-N-(1-azabicyclo[2.2.2]octan-3-yloxy)-7-oxo-6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | (2S,5R)-N-(1-azabicyclo[2.2.2]octan-3-yloxy)-7-oxo-6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 155068282 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (2S,5R)-N-(1-azabicyclo[2.2.2]octan-3-yloxy)-7-oxo-6-sulfanyloxy-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | O=C(NOC1CN2CCC1CC2)[C@@H]1CC[C@@H]2CN1C(=O)N2OS |
| InChI | InChI=1S/C14H22N4O4S/c19-13(15-21-12-8-16-5-3-9(12)4-6-16)11-2-1-10-7-17(11)14(20)18(10)22-23/h9-12,23H,1-8H2,(H,15,19)/t10-,11+,12?/m1/s1 |
| InChIKey | WPUFHARQIJKLRY-UBNQGINQSA-N |
| XLogP | 0.17 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|