C17H28O7 — CID 155133411
(2,5-dioxocyclopentyl) 4-(4,4-dihydroxy-2,2-dimethylbutoxy)-3,3-dimethylbutanoate (PubChem CID 155133411) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is (2,5-dioxocyclopentyl) 4-(4,4-dihydroxy-2,2-dimethylbutoxy)-3,3-dimethylbutanoate.
| Compound Name | (2,5-dioxocyclopentyl) 4-(4,4-dihydroxy-2,2-dimethylbutoxy)-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 155133411 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (2,5-dioxocyclopentyl) 4-(4,4-dihydroxy-2,2-dimethylbutoxy)-3,3-dimethylbutanoate |
| SMILES | CC(C)(COCC(C)(C)CC(O)O)CC(=O)OC1C(=O)CCC1=O |
| InChI | InChI=1S/C17H28O7/c1-16(2,7-13(20)21)9-23-10-17(3,4)8-14(22)24-15-11(18)5-6-12(15)19/h13,15,20-21H,5-10H2,1-4H3 |
| InChIKey | AFMRPBVLUXFTOU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|