C18H26F2NO6P — CID 155149382
propan-2-yl 2-[[[(3S)-2,3-difluoro-2-hydroxyhex-4-enoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 155149382) has the molecular formula C18H26F2NO6P and a molecular weight of 421.38 g/mol. Its IUPAC name is propan-2-yl 2-[[[(3S)-2,3-difluoro-2-hydroxyhex-4-enoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(3S)-2,3-difluoro-2-hydroxyhex-4-enoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 155149382 |
| Molecular Formula | C18H26F2NO6P |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | propan-2-yl 2-[[[(3S)-2,3-difluoro-2-hydroxyhex-4-enoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC=C[C@H](F)C(O)(F)COP(=O)(NC(C)C(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C18H26F2NO6P/c1-5-9-16(19)18(20,23)12-25-28(24,27-15-10-7-6-8-11-15)21-14(4)17(22)26-13(2)3/h5-11,13-14,16,23H,12H2,1-4H3,(H,21,24)/t14?,16-,18?,28?/m0/s1 |
| InChIKey | SIUHHHAVTRNCHQ-YIMRHHMHSA-N |
| XLogP | 3.69 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|