C29H38F2N6O3 — CID 155171415
4-[[(2S)-3-fluoro-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(7-fluoro-2-methylquinazolin-4-yl)amino]butanoic acid (PubChem CID 155171415) has the molecular formula C29H38F2N6O3 and a molecular weight of 556.66 g/mol. Its IUPAC name is 4-[[(2S)-3-fluoro-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(7-fluoro-2-methylquinazolin-4-yl)amino]butanoic acid.
| Compound Name | 4-[[(2S)-3-fluoro-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(7-fluoro-2-methylquinazolin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 155171415 |
| Molecular Formula | C29H38F2N6O3 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 4-[[(2S)-3-fluoro-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(7-fluoro-2-methylquinazolin-4-yl)amino]butanoic acid |
| SMILES | CO[C@H](CF)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1nc(C)nc2cc(F)ccc12)C(=O)O |
| InChI | InChI=1S/C29H38F2N6O3/c1-19-33-26-16-21(31)9-11-24(26)28(34-19)36-25(29(38)39)12-15-37(18-23(17-30)40-2)14-4-3-7-22-10-8-20-6-5-13-32-27(20)35-22/h8-11,16,23,25H,3-7,12-15,17-18H2,1-2H3,(H,32,35)(H,38,39)(H,33,34,36)/t23-,25?/m1/s1 |
| InChIKey | ZWZNVJZVCPBXJU-XQZUBTRRSA-N |
| XLogP | 4.40 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|