C9H17F2IO — CID 155198944
(2R,3R)-1,1-difluoro-3-(1-iodoethyl)heptan-2-ol (PubChem CID 155198944) has the molecular formula C9H17F2IO and a molecular weight of 306.13 g/mol. Its IUPAC name is (2R,3R)-1,1-difluoro-3-(1-iodoethyl)heptan-2-ol.
| Compound Name | (2R,3R)-1,1-difluoro-3-(1-iodoethyl)heptan-2-ol |
|---|---|
| PubChem CID | 155198944 |
| Molecular Formula | C9H17F2IO |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | (2R,3R)-1,1-difluoro-3-(1-iodoethyl)heptan-2-ol |
| SMILES | CCCC[C@@H](C(C)I)[C@@H](O)C(F)F |
| InChI | InChI=1S/C9H17F2IO/c1-3-4-5-7(6(2)12)8(13)9(10)11/h6-9,13H,3-5H2,1-2H3/t6?,7-,8+/m0/s1 |
| InChIKey | LGHFDGDOBCSILR-ZHFSPANRSA-N |
| XLogP | 3.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|