C23H20F2O7 — CID 155215474
[3-fluoro-4-[(E)-3-[4-(2-fluoroprop-2-enoyloxy)phenoxy]-3-hydroxyprop-1-enyl]phenyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 155215474) has the molecular formula C23H20F2O7 and a molecular weight of 446.40 g/mol. Its IUPAC name is [3-fluoro-4-[(E)-3-[4-(2-fluoroprop-2-enoyloxy)phenoxy]-3-hydroxyprop-1-enyl]phenyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [3-fluoro-4-[(E)-3-[4-(2-fluoroprop-2-enoyloxy)phenoxy]-3-hydroxyprop-1-enyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 155215474 |
| Molecular Formula | C23H20F2O7 |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | [3-fluoro-4-[(E)-3-[4-(2-fluoroprop-2-enoyloxy)phenoxy]-3-hydroxyprop-1-enyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(F)C(=O)Oc1ccc(OC(O)/C=C/c2ccc(OC(=O)C(=C)COC)cc2F)cc1 |
| InChI | InChI=1S/C23H20F2O7/c1-14(13-29-3)22(27)32-19-6-4-16(20(25)12-19)5-11-21(26)30-17-7-9-18(10-8-17)31-23(28)15(2)24/h4-12,21,26H,1-2,13H2,3H3/b11-5+ |
| InChIKey | MCIDSWSCJYPDAK-VZUCSPMQSA-N |
| XLogP | 3.73 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|