C18H24ClN5NaO4S — CID 155225439
CID 155225439 (PubChem CID 155225439) has the molecular formula C18H24ClN5NaO4S and a molecular weight of 464.93 g/mol.
| Compound Name | CID 155225439 |
|---|---|
| PubChem CID | 155225439 |
| Molecular Formula | C18H24ClN5NaO4S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | — |
| SMILES | CCc1cc(Cl)cc(NC(=O)NS(=O)(=O)N(c2cnn(C)c2)C2CCOCC2)c1.[Na] |
| InChI | InChI=1S/C18H24ClN5O4S.Na/c1-3-13-8-14(19)10-15(9-13)21-18(25)22-29(26,27)24(16-4-6-28-7-5-16)17-11-20-23(2)12-17;/h8-12,16H,3-7H2,1-2H3,(H2,21,22,25); |
| InChIKey | PVBVGMJIKVQPRI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |