C13H18N5O3PS — CID 155226806
(Z)-2-acetylsulfanylethyl-[1-(6-aminopurin-9-yl)propan-2-yloxymethylidene]-oxidophosphanium (PubChem CID 155226806) has the molecular formula C13H18N5O3PS and a molecular weight of 355.36 g/mol. Its IUPAC name is (Z)-2-acetylsulfanylethyl-[1-(6-aminopurin-9-yl)propan-2-yloxymethylidene]-oxidophosphanium.
| Compound Name | (Z)-2-acetylsulfanylethyl-[1-(6-aminopurin-9-yl)propan-2-yloxymethylidene]-oxidophosphanium |
|---|---|
| PubChem CID | 155226806 |
| Molecular Formula | C13H18N5O3PS |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (Z)-2-acetylsulfanylethyl-[1-(6-aminopurin-9-yl)propan-2-yloxymethylidene]-oxidophosphanium |
| SMILES | CC(=O)SCC/[P+]([O-])=C/OC(C)Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H18N5O3PS/c1-9(21-8-22(20)3-4-23-10(2)19)5-18-7-17-11-12(14)15-6-16-13(11)18/h6-9H,3-5H2,1-2H3,(H2,14,15,16) |
| InChIKey | CGOJETYMIHVXCA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|