C14H20O6S — CID 155255692
4-O-cyclohexyl 1-O-(1,1-dioxothietan-3-yl) 2-methylidenebutanedioate (PubChem CID 155255692) has the molecular formula C14H20O6S and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-(1,1-dioxothietan-3-yl) 2-methylidenebutanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-(1,1-dioxothietan-3-yl) 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 155255692 |
| Molecular Formula | C14H20O6S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-O-cyclohexyl 1-O-(1,1-dioxothietan-3-yl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC1CCCCC1)C(=O)OC1CS(=O)(=O)C1 |
| InChI | InChI=1S/C14H20O6S/c1-10(14(16)20-12-8-21(17,18)9-12)7-13(15)19-11-5-3-2-4-6-11/h11-12H,1-9H2 |
| InChIKey | BJHJCAHZZCWGAC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|