C19H29NO7 — CID 155255749
(2R,3S)-2-acetamido-3-(4-cyclooctyloxy-2-methylidene-4-oxobutanoyl)oxybutanoic acid (PubChem CID 155255749) has the molecular formula C19H29NO7 and a molecular weight of 383.44 g/mol. Its IUPAC name is (2R,3S)-2-acetamido-3-(4-cyclooctyloxy-2-methylidene-4-oxobutanoyl)oxybutanoic acid.
| Compound Name | (2R,3S)-2-acetamido-3-(4-cyclooctyloxy-2-methylidene-4-oxobutanoyl)oxybutanoic acid |
|---|---|
| PubChem CID | 155255749 |
| Molecular Formula | C19H29NO7 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (2R,3S)-2-acetamido-3-(4-cyclooctyloxy-2-methylidene-4-oxobutanoyl)oxybutanoic acid |
| SMILES | C=C(CC(=O)OC1CCCCCCC1)C(=O)O[C@@H](C)[C@@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C19H29NO7/c1-12(11-16(22)27-15-9-7-5-4-6-8-10-15)19(25)26-13(2)17(18(23)24)20-14(3)21/h13,15,17H,1,4-11H2,2-3H3,(H,20,21)(H,23,24)/t13-,17+/m0/s1 |
| InChIKey | LEKPPJVPBQEBLG-SUMWQHHRSA-N |
| XLogP | 2.11 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|