C14H17F3O6 — CID 155255476
2-(4-cyclohexyloxy-2-methylidene-4-oxobutanoyl)oxy-3,3,3-trifluoropropanoic acid (PubChem CID 155255476) has the molecular formula C14H17F3O6 and a molecular weight of 338.28 g/mol. Its IUPAC name is 2-(4-cyclohexyloxy-2-methylidene-4-oxobutanoyl)oxy-3,3,3-trifluoropropanoic acid.
| Compound Name | 2-(4-cyclohexyloxy-2-methylidene-4-oxobutanoyl)oxy-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 155255476 |
| Molecular Formula | C14H17F3O6 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-(4-cyclohexyloxy-2-methylidene-4-oxobutanoyl)oxy-3,3,3-trifluoropropanoic acid |
| SMILES | C=C(CC(=O)OC1CCCCC1)C(=O)OC(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C14H17F3O6/c1-8(7-10(18)22-9-5-3-2-4-6-9)13(21)23-11(12(19)20)14(15,16)17/h9,11H,1-7H2,(H,19,20) |
| InChIKey | REFIMQORYQXKRL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|