C27H37NO8 — CID 155259699
1-O-[(2R,3S)-3-acetamido-4-[(4-methoxyphenyl)methoxy]-4-oxobutan-2-yl] 4-O-cyclooctyl 2-methylidenebutanedioate (PubChem CID 155259699) has the molecular formula C27H37NO8 and a molecular weight of 503.59 g/mol. Its IUPAC name is 1-O-[(2R,3S)-3-acetamido-4-[(4-methoxyphenyl)methoxy]-4-oxobutan-2-yl] 4-O-cyclooctyl 2-methylidenebutanedioate.
| Compound Name | 1-O-[(2R,3S)-3-acetamido-4-[(4-methoxyphenyl)methoxy]-4-oxobutan-2-yl] 4-O-cyclooctyl 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 155259699 |
| Molecular Formula | C27H37NO8 |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 1-O-[(2R,3S)-3-acetamido-4-[(4-methoxyphenyl)methoxy]-4-oxobutan-2-yl] 4-O-cyclooctyl 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC1CCCCCCC1)C(=O)O[C@H](C)[C@H](NC(C)=O)C(=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H37NO8/c1-18(16-24(30)36-23-10-8-6-5-7-9-11-23)26(31)35-19(2)25(28-20(3)29)27(32)34-17-21-12-14-22(33-4)15-13-21/h12-15,19,23,25H,1,5-11,16-17H2,2-4H3,(H,28,29)/t19-,25+/m1/s1 |
| InChIKey | FYWPDQIRGNRPJZ-CLOONOSVSA-N |
| XLogP | 3.78 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|