C37H38FN9O6 — CID 155281243
N-[3-[[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]amino]-3-oxopropyl]-6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanamide (PubChem CID 155281243) has the molecular formula C37H38FN9O6 and a molecular weight of 723.77 g/mol. Its IUPAC name is N-[3-[[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]amino]-3-oxopropyl]-6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanamide.
| Compound Name | N-[3-[[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]amino]-3-oxopropyl]-6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanamide |
|---|---|
| PubChem CID | 155281243 |
| Molecular Formula | C37H38FN9O6 |
| Molecular Weight | 723.77 g/mol |
| Exact Mass | 723.29 |
| IUPAC Name | N-[3-[[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]amino]-3-oxopropyl]-6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanamide |
| SMILES | Cc1c(N)cncc1-c1cc2cc(NC(=O)CCNC(=O)CCCCCNc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)ncc2c(N)c1F |
| InChI | InChI=1S/C37H38FN9O6/c1-19-23(16-41-18-25(19)39)22-14-20-15-28(44-17-24(20)34(40)33(22)38)45-31(50)11-13-43-29(48)8-3-2-4-12-42-26-7-5-6-21-32(26)37(53)47(36(21)52)27-9-10-30(49)46-35(27)51/h5-7,14-18,27,42H,2-4,8-13,39-40H2,1H3,(H,43,48)(H,44,45,50)(H,46,49,51) |
| InChIKey | OHPRUTDCIXKWDF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 231.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.77 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|