C37H38FN9O7 — CID 155281246
N'-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]-N-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]pentanediamide (PubChem CID 155281246) has the molecular formula C37H38FN9O7 and a molecular weight of 739.77 g/mol. Its IUPAC name is N'-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]-N-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]pentanediamide.
| Compound Name | N'-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]-N-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]pentanediamide |
|---|---|
| PubChem CID | 155281246 |
| Molecular Formula | C37H38FN9O7 |
| Molecular Weight | 739.77 g/mol |
| Exact Mass | 739.29 |
| IUPAC Name | N'-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]-N-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl]pentanediamide |
| SMILES | Cc1c(N)cncc1-c1cc2cc(NC(=O)CCCC(=O)NCCOCCNc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)ncc2c(N)c1F |
| InChI | InChI=1S/C37H38FN9O7/c1-19-23(16-41-18-25(19)39)22-14-20-15-28(44-17-24(20)34(40)33(22)38)45-30(49)7-3-6-29(48)43-11-13-54-12-10-42-26-5-2-4-21-32(26)37(53)47(36(21)52)27-8-9-31(50)46-35(27)51/h2,4-5,14-18,27,42H,3,6-13,39-40H2,1H3,(H,43,48)(H,44,45,49)(H,46,50,51) |
| InChIKey | LPBZQCNODOEEJA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 240.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|