C12H25N3 — CID 155299178
(1E,3E)-1-N-[2-(dimethylamino)ethyl]-1-N,3-dimethylhexa-1,3-diene-1,2-diamine (PubChem CID 155299178) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is (1E,3E)-1-N-[2-(dimethylamino)ethyl]-1-N,3-dimethylhexa-1,3-diene-1,2-diamine.
| Compound Name | (1E,3E)-1-N-[2-(dimethylamino)ethyl]-1-N,3-dimethylhexa-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 155299178 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | (1E,3E)-1-N-[2-(dimethylamino)ethyl]-1-N,3-dimethylhexa-1,3-diene-1,2-diamine |
| SMILES | CC/C=C(C)/C(N)=C\N(C)CCN(C)C |
| InChI | InChI=1S/C12H25N3/c1-6-7-11(2)12(13)10-15(5)9-8-14(3)4/h7,10H,6,8-9,13H2,1-5H3/b11-7+,12-10+ |
| InChIKey | YNKDDYYNRQJAQG-CRALUGIISA-N |
| XLogP | 1.64 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|