C44H65NO9 — CID 155301701
8-prop-2-enoyloxyoctyl 4-[methyl-[4-[4-(8-prop-2-enoyloxyoctoxycarbonyl)cyclohexyl]cyclohexanecarbonyl]amino]benzoate (PubChem CID 155301701) has the molecular formula C44H65NO9 and a molecular weight of 752.00 g/mol. Its IUPAC name is 8-prop-2-enoyloxyoctyl 4-[methyl-[4-[4-(8-prop-2-enoyloxyoctoxycarbonyl)cyclohexyl]cyclohexanecarbonyl]amino]benzoate.
| Compound Name | 8-prop-2-enoyloxyoctyl 4-[methyl-[4-[4-(8-prop-2-enoyloxyoctoxycarbonyl)cyclohexyl]cyclohexanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 155301701 |
| Molecular Formula | C44H65NO9 |
| Molecular Weight | 752.00 g/mol |
| Exact Mass | 751.47 |
| IUPAC Name | 8-prop-2-enoyloxyoctyl 4-[methyl-[4-[4-(8-prop-2-enoyloxyoctoxycarbonyl)cyclohexyl]cyclohexanecarbonyl]amino]benzoate |
| SMILES | C=CC(=O)OCCCCCCCCOC(=O)c1ccc(N(C)C(=O)C2CCC(C3CCC(C(=O)OCCCCCCCCOC(=O)C=C)CC3)CC2)cc1 |
| InChI | InChI=1S/C44H65NO9/c1-4-40(46)51-30-14-10-6-8-12-16-32-53-43(49)37-24-20-35(21-25-37)34-18-22-36(23-19-34)42(48)45(3)39-28-26-38(27-29-39)44(50)54-33-17-13-9-7-11-15-31-52-41(47)5-2/h4-5,26-29,34-37H,1-2,6-25,30-33H2,3H3 |
| InChIKey | FYSRMZOJZZBXPE-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.00 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|