C25H44O2S — CID 155301859
[4,8-diethyl-4,8-dimethyl-9-(3-methylbuta-1,3-dien-2-ylsulfanyl)decan-2-yl] 2-methylprop-2-enoate (PubChem CID 155301859) has the molecular formula C25H44O2S and a molecular weight of 408.69 g/mol. Its IUPAC name is [4,8-diethyl-4,8-dimethyl-9-(3-methylbuta-1,3-dien-2-ylsulfanyl)decan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [4,8-diethyl-4,8-dimethyl-9-(3-methylbuta-1,3-dien-2-ylsulfanyl)decan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155301859 |
| Molecular Formula | C25H44O2S |
| Molecular Weight | 408.69 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | [4,8-diethyl-4,8-dimethyl-9-(3-methylbuta-1,3-dien-2-ylsulfanyl)decan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=C)SC(C)C(C)(CC)CCCC(C)(CC)CC(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C25H44O2S/c1-12-24(10,17-20(7)27-23(26)19(5)6)15-14-16-25(11,13-2)22(9)28-21(8)18(3)4/h20,22H,3,5,8,12-17H2,1-2,4,6-7,9-11H3 |
| InChIKey | QBDSITRETCGGBZ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.69 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|