C26H28F3N5OS — CID 155311570
1-(2,6-dimethylphenyl)-3-[2-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]cyclohex-2-en-1-yl]ethyl]thiourea (PubChem CID 155311570) has the molecular formula C26H28F3N5OS and a molecular weight of 515.61 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[2-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]cyclohex-2-en-1-yl]ethyl]thiourea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[2-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]cyclohex-2-en-1-yl]ethyl]thiourea |
|---|---|
| PubChem CID | 155311570 |
| Molecular Formula | C26H28F3N5OS |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[2-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]cyclohex-2-en-1-yl]ethyl]thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)NCCC1C=C(c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)CCC1 |
| InChI | InChI=1S/C26H28F3N5OS/c1-17-5-3-6-18(2)23(17)32-25(36)30-14-13-19-7-4-8-20(15-19)24-31-16-34(33-24)21-9-11-22(12-10-21)35-26(27,28)29/h3,5-6,9-12,15-16,19H,4,7-8,13-14H2,1-2H3,(H2,30,32,36) |
| InChIKey | MEDRKGHWAIIZHA-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 64.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|