C19H24N2O2 — CID 155345531
5-(3,6-dimethoxynaphthalen-2-yl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 155345531) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 5-(3,6-dimethoxynaphthalen-2-yl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(3,6-dimethoxynaphthalen-2-yl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 155345531 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 5-(3,6-dimethoxynaphthalen-2-yl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | COc1ccc2cc(N3CC4CN(C)CC4C3)c(OC)cc2c1 |
| InChI | InChI=1S/C19H24N2O2/c1-20-9-15-11-21(12-16(15)10-20)18-7-13-4-5-17(22-2)6-14(13)8-19(18)23-3/h4-8,15-16H,9-12H2,1-3H3 |
| InChIKey | WJKRPFSGACMFDZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |