C27H38N2O7S2 — CID 155445404
(2S,3S)-3-[(1R)-1-hydroxyethyl]-2-[[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbothioylamino]-4-oxoazetidine-1-sulfonic acid (PubChem CID 155445404) has the molecular formula C27H38N2O7S2 and a molecular weight of 566.74 g/mol. Its IUPAC name is (2S,3S)-3-[(1R)-1-hydroxyethyl]-2-[[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbothioylamino]-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3S)-3-[(1R)-1-hydroxyethyl]-2-[[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbothioylamino]-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 155445404 |
| Molecular Formula | C27H38N2O7S2 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | (2S,3S)-3-[(1R)-1-hydroxyethyl]-2-[[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbothioylamino]-4-oxoazetidine-1-sulfonic acid |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=S)N[C@@H]1[C@@H]([C@@H](C)O)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C27H38N2O7S2/c1-6-7-8-9-18-13-21(31)24(20-12-16(4)10-11-19(20)15(2)3)22(14-18)36-27(37)28-25-23(17(5)30)26(32)29(25)38(33,34)35/h12-14,17,19-20,23,25,30-31H,2,6-11H2,1,3-5H3,(H,28,37)(H,33,34,35)/t17-,19+,20-,23-,25+/m1/s1 |
| InChIKey | NVVWYLPIUSXSBK-XYGUAXKYSA-N |
| XLogP | 4.36 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|